C12H13BrF3NO — CID 113376787
N-(4-bromopentan-2-yl)-3,4,5-trifluorobenzamide (PubChem CID 113376787) has the molecular formula C12H13BrF3NO and a molecular weight of 324.14 g/mol. Its IUPAC name is N-(4-bromopentan-2-yl)-3,4,5-trifluorobenzamide.
| Compound Name | N-(4-bromopentan-2-yl)-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 113376787 |
| Molecular Formula | C12H13BrF3NO |
| Molecular Weight | 324.14 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | N-(4-bromopentan-2-yl)-3,4,5-trifluorobenzamide |
| SMILES | CC(Br)CC(C)NC(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H13BrF3NO/c1-6(13)3-7(2)17-12(18)8-4-9(14)11(16)10(15)5-8/h4-7H,3H2,1-2H3,(H,17,18) |
| InChIKey | BMQVIGJOVLWJCU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.14 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|