C12H15F2NO2 — CID 97350116
3,5-difluoro-N-[(2R,4R)-4-hydroxypentan-2-yl]benzamide (PubChem CID 97350116) has the molecular formula C12H15F2NO2 and a molecular weight of 243.25 g/mol. Its IUPAC name is 3,5-difluoro-N-[(2R,4R)-4-hydroxypentan-2-yl]benzamide.
| Compound Name | 3,5-difluoro-N-[(2R,4R)-4-hydroxypentan-2-yl]benzamide |
|---|---|
| PubChem CID | 97350116 |
| Molecular Formula | C12H15F2NO2 |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 3,5-difluoro-N-[(2R,4R)-4-hydroxypentan-2-yl]benzamide |
| SMILES | C[C@H](C[C@@H](C)O)NC(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H15F2NO2/c1-7(3-8(2)16)15-12(17)9-4-10(13)6-11(14)5-9/h4-8,16H,3H2,1-2H3,(H,15,17)/t7-,8-/m1/s1 |
| InChIKey | BQVUTZLNKCSKIU-HTQZYQBOSA-N |
| XLogP | 1.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |