C12H14F2N2O4 — CID 107122263
2,5-difluoro-N-(4-hydroxypentan-2-yl)-3-nitrobenzamide (PubChem CID 107122263) has the molecular formula C12H14F2N2O4 and a molecular weight of 288.25 g/mol. Its IUPAC name is 2,5-difluoro-N-(4-hydroxypentan-2-yl)-3-nitrobenzamide.
| Compound Name | 2,5-difluoro-N-(4-hydroxypentan-2-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 107122263 |
| Molecular Formula | C12H14F2N2O4 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2,5-difluoro-N-(4-hydroxypentan-2-yl)-3-nitrobenzamide |
| SMILES | CC(O)CC(C)NC(=O)c1cc(F)cc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C12H14F2N2O4/c1-6(3-7(2)17)15-12(18)9-4-8(13)5-10(11(9)14)16(19)20/h4-7,17H,3H2,1-2H3,(H,15,18) |
| InChIKey | FPQQXBXXEJAYFY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|