C12H13BrN2O2 — CID 113442307
4-bromo-N-(1-cyanobutan-2-yl)-3-hydroxybenzamide (PubChem CID 113442307) has the molecular formula C12H13BrN2O2 and a molecular weight of 297.15 g/mol. Its IUPAC name is 4-bromo-N-(1-cyanobutan-2-yl)-3-hydroxybenzamide.
| Compound Name | 4-bromo-N-(1-cyanobutan-2-yl)-3-hydroxybenzamide |
|---|---|
| PubChem CID | 113442307 |
| Molecular Formula | C12H13BrN2O2 |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 4-bromo-N-(1-cyanobutan-2-yl)-3-hydroxybenzamide |
| SMILES | CCC(CC#N)NC(=O)c1ccc(Br)c(O)c1 |
| InChI | InChI=1S/C12H13BrN2O2/c1-2-9(5-6-14)15-12(17)8-3-4-10(13)11(16)7-8/h3-4,7,9,16H,2,5H2,1H3,(H,15,17) |
| InChIKey | LWWOMAQYXIQPTL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |