C13H7F5N2O — CID 63185686
4-amino-3,5-difluoro-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 63185686) has the molecular formula C13H7F5N2O and a molecular weight of 302.20 g/mol. Its IUPAC name is 4-amino-3,5-difluoro-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-amino-3,5-difluoro-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 63185686 |
| Molecular Formula | C13H7F5N2O |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 4-amino-3,5-difluoro-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | Nc1c(F)cc(C(=O)Nc2cc(F)c(F)c(F)c2)cc1F |
| InChI | InChI=1S/C13H7F5N2O/c14-7-3-6(4-8(15)11(7)18)20-13(21)5-1-9(16)12(19)10(17)2-5/h1-4H,19H2,(H,20,21) |
| InChIKey | ZYHMHJLXLMSPKD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|