C13H6Cl2F3NO2 — CID 82881371
N-(3,5-dichloro-4-hydroxyphenyl)-3,4,5-trifluorobenzamide (PubChem CID 82881371) has the molecular formula C13H6Cl2F3NO2 and a molecular weight of 336.10 g/mol. Its IUPAC name is N-(3,5-dichloro-4-hydroxyphenyl)-3,4,5-trifluorobenzamide.
| Compound Name | N-(3,5-dichloro-4-hydroxyphenyl)-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 82881371 |
| Molecular Formula | C13H6Cl2F3NO2 |
| Molecular Weight | 336.10 g/mol |
| Exact Mass | 334.97 |
| IUPAC Name | N-(3,5-dichloro-4-hydroxyphenyl)-3,4,5-trifluorobenzamide |
| SMILES | O=C(Nc1cc(Cl)c(O)c(Cl)c1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H6Cl2F3NO2/c14-7-3-6(4-8(15)12(7)20)19-13(21)5-1-9(16)11(18)10(17)2-5/h1-4,20H,(H,19,21) |
| InChIKey | AXUFRUNVXQPCJH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.10 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|