C13H7Br2Cl2NO3 — CID 169122474
3,5-dibromo-N-(3,5-dichloro-4-hydroxyphenyl)-4-hydroxybenzamide (PubChem CID 169122474) has the molecular formula C13H7Br2Cl2NO3 and a molecular weight of 455.92 g/mol. Its IUPAC name is 3,5-dibromo-N-(3,5-dichloro-4-hydroxyphenyl)-4-hydroxybenzamide.
| Compound Name | 3,5-dibromo-N-(3,5-dichloro-4-hydroxyphenyl)-4-hydroxybenzamide |
|---|---|
| PubChem CID | 169122474 |
| Molecular Formula | C13H7Br2Cl2NO3 |
| Molecular Weight | 455.92 g/mol |
| Exact Mass | 452.82 |
| IUPAC Name | 3,5-dibromo-N-(3,5-dichloro-4-hydroxyphenyl)-4-hydroxybenzamide |
| SMILES | O=C(Nc1cc(Cl)c(O)c(Cl)c1)c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C13H7Br2Cl2NO3/c14-7-1-5(2-8(15)11(7)19)13(21)18-6-3-9(16)12(20)10(17)4-6/h1-4,19-20H,(H,18,21) |
| InChIKey | UBIAPLSCTPSLQJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.92 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|