C13H7Br2Cl2NO2 — CID 5119267
2,5-dichloro-N-(3,5-dibromo-4-hydroxyphenyl)benzamide (PubChem CID 5119267) has the molecular formula C13H7Br2Cl2NO2 and a molecular weight of 439.92 g/mol. Its IUPAC name is 2,5-dichloro-N-(3,5-dibromo-4-hydroxyphenyl)benzamide.
| Compound Name | 2,5-dichloro-N-(3,5-dibromo-4-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 5119267 |
| Molecular Formula | C13H7Br2Cl2NO2 |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 436.82 |
| IUPAC Name | 2,5-dichloro-N-(3,5-dibromo-4-hydroxyphenyl)benzamide |
| SMILES | O=C(Nc1cc(Br)c(O)c(Br)c1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H7Br2Cl2NO2/c14-9-4-7(5-10(15)12(9)19)18-13(20)8-3-6(16)1-2-11(8)17/h1-5,19H,(H,18,20) |
| InChIKey | IFLWCZRMFPKYBN-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|