C13H7BrCl2INO — CID 114259361
N-(4-bromo-3-iodophenyl)-2,5-dichlorobenzamide (PubChem CID 114259361) has the molecular formula C13H7BrCl2INO and a molecular weight of 470.92 g/mol. Its IUPAC name is N-(4-bromo-3-iodophenyl)-2,5-dichlorobenzamide.
| Compound Name | N-(4-bromo-3-iodophenyl)-2,5-dichlorobenzamide |
|---|---|
| PubChem CID | 114259361 |
| Molecular Formula | C13H7BrCl2INO |
| Molecular Weight | 470.92 g/mol |
| Exact Mass | 468.81 |
| IUPAC Name | N-(4-bromo-3-iodophenyl)-2,5-dichlorobenzamide |
| SMILES | O=C(Nc1ccc(Br)c(I)c1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H7BrCl2INO/c14-10-3-2-8(6-12(10)17)18-13(19)9-5-7(15)1-4-11(9)16/h1-6H,(H,18,19) |
| InChIKey | GDUSVUSJYWDJLP-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.92 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|