C11H9Cl2N3O2 — CID 82885113
N-(3,5-dichloro-4-hydroxyphenyl)-1-methylpyrazole-4-carboxamide (PubChem CID 82885113) has the molecular formula C11H9Cl2N3O2 and a molecular weight of 286.12 g/mol. Its IUPAC name is N-(3,5-dichloro-4-hydroxyphenyl)-1-methylpyrazole-4-carboxamide.
| Compound Name | N-(3,5-dichloro-4-hydroxyphenyl)-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 82885113 |
| Molecular Formula | C11H9Cl2N3O2 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | N-(3,5-dichloro-4-hydroxyphenyl)-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2cc(Cl)c(O)c(Cl)c2)cn1 |
| InChI | InChI=1S/C11H9Cl2N3O2/c1-16-5-6(4-14-16)11(18)15-7-2-8(12)10(17)9(13)3-7/h2-5,17H,1H3,(H,15,18) |
| InChIKey | QURKZQPCSFSJLW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|