C13H15N5O2 — CID 47143175
1-methyl-N-[4-(methylcarbamoylamino)phenyl]pyrazole-4-carboxamide (PubChem CID 47143175) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is 1-methyl-N-[4-(methylcarbamoylamino)phenyl]pyrazole-4-carboxamide.
| Compound Name | 1-methyl-N-[4-(methylcarbamoylamino)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 47143175 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 1-methyl-N-[4-(methylcarbamoylamino)phenyl]pyrazole-4-carboxamide |
| SMILES | CNC(=O)Nc1ccc(NC(=O)c2cnn(C)c2)cc1 |
| InChI | InChI=1S/C13H15N5O2/c1-14-13(20)17-11-5-3-10(4-6-11)16-12(19)9-7-15-18(2)8-9/h3-8H,1-2H3,(H,16,19)(H2,14,17,20) |
| InChIKey | VPXZCEVSHBFWIN-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |