C14H11F3N2O2 — CID 63186712
N-(3-amino-4-methoxyphenyl)-3,4,5-trifluorobenzamide (PubChem CID 63186712) has the molecular formula C14H11F3N2O2 and a molecular weight of 296.25 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-3,4,5-trifluorobenzamide.
| Compound Name | N-(3-amino-4-methoxyphenyl)-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 63186712 |
| Molecular Formula | C14H11F3N2O2 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-3,4,5-trifluorobenzamide |
| SMILES | COc1ccc(NC(=O)c2cc(F)c(F)c(F)c2)cc1N |
| InChI | InChI=1S/C14H11F3N2O2/c1-21-12-3-2-8(6-11(12)18)19-14(20)7-4-9(15)13(17)10(16)5-7/h2-6H,18H2,1H3,(H,19,20) |
| InChIKey | VNUBKVWEGWLHEZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|