About N-(3-amino-4-methoxyphenyl)benzamide;molecular nitrogen
N-(3-amino-4-methoxyphenyl)benzamide;molecular nitrogen (PubChem CID 174994775) has the molecular formula C14H14N4O2
and a molecular weight of 270.29 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)benzamide;molecular nitrogen.
Molecular Properties
| Compound Name | N-(3-amino-4-methoxyphenyl)benzamide;molecular nitrogen |
| PubChem CID | 174994775 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)benzamide;molecular nitrogen |
| SMILES | COc1ccc(NC(=O)c2ccccc2)cc1N.N#N |
| InChI | InChI=1S/C14H14N2O2.N2/c1-18-13-8-7-11(9-12(13)15)16-14(17)10-5-3-2-4-6-10;1-2/h2-9H,15H2,1H3,(H,16,17); |
| InChIKey | AFXUWVCQFWRYHV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 111.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(3-amino-4-methoxyphenyl)benzamide;molecular nitrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-amino-4-methoxyphenyl)benzamide;molecular nitrogen?
The IUPAC name of N-(3-amino-4-methoxyphenyl)benzamide;molecular nitrogen (CID 174994775) is N-(3-amino-4-methoxyphenyl)benzamide;molecular nitrogen.
What is the SMILES notation for N-(3-amino-4-methoxyphenyl)benzamide;molecular nitrogen?
The canonical SMILES for N-(3-amino-4-methoxyphenyl)benzamide;molecular nitrogen is COc1ccc(NC(=O)c2ccccc2)cc1N.N#N.
What is the InChIKey of N-(3-amino-4-methoxyphenyl)benzamide;molecular nitrogen?
The InChIKey is AFXUWVCQFWRYHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O2.N2/c1-18-13-8-7-11(9-12(13)15)16-14(17)10-5-3-2-4-6-10;1-2/h2-9H,15H2,1H3,(H,16,17);.
What are the key properties of N-(3-amino-4-methoxyphenyl)benzamide;molecular nitrogen?
N-(3-amino-4-methoxyphenyl)benzamide;molecular nitrogen has a molecular weight of 270.29 g/mol, XLogP of 2.56, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-amino-4-methoxyphenyl)benzamide;molecular nitrogen is sourced from PubChem (CID 174994775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).