C14H17N3O4S — CID 87934381
(2R)-2-acetamido-3-benzylsulfonyl-N-(cyanomethyl)propanamide (PubChem CID 87934381) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is (2R)-2-acetamido-3-benzylsulfonyl-N-(cyanomethyl)propanamide.
| Compound Name | (2R)-2-acetamido-3-benzylsulfonyl-N-(cyanomethyl)propanamide |
|---|---|
| PubChem CID | 87934381 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | (2R)-2-acetamido-3-benzylsulfonyl-N-(cyanomethyl)propanamide |
| SMILES | CC(=O)N[C@@H](CS(=O)(=O)Cc1ccccc1)C(=O)NCC#N |
| InChI | InChI=1S/C14H17N3O4S/c1-11(18)17-13(14(19)16-8-7-15)10-22(20,21)9-12-5-3-2-4-6-12/h2-6,13H,8-10H2,1H3,(H,16,19)(H,17,18)/t13-/m0/s1 |
| InChIKey | YATHEHGNTGKUPI-ZDUSSCGKSA-N |
| XLogP | -0.25 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|