C16H21N3O6S — CID 57451896
[3-benzylsulfonyl-1-(cyanomethylamino)-1-oxopropan-2-yl] N-(2-methoxyethyl)carbamate (PubChem CID 57451896) has the molecular formula C16H21N3O6S and a molecular weight of 383.43 g/mol. Its IUPAC name is [3-benzylsulfonyl-1-(cyanomethylamino)-1-oxopropan-2-yl] N-(2-methoxyethyl)carbamate.
| Compound Name | [3-benzylsulfonyl-1-(cyanomethylamino)-1-oxopropan-2-yl] N-(2-methoxyethyl)carbamate |
|---|---|
| PubChem CID | 57451896 |
| Molecular Formula | C16H21N3O6S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | [3-benzylsulfonyl-1-(cyanomethylamino)-1-oxopropan-2-yl] N-(2-methoxyethyl)carbamate |
| SMILES | COCCNC(=O)OC(CS(=O)(=O)Cc1ccccc1)C(=O)NCC#N |
| InChI | InChI=1S/C16H21N3O6S/c1-24-10-9-19-16(21)25-14(15(20)18-8-7-17)12-26(22,23)11-13-5-3-2-4-6-13/h2-6,14H,8-12H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | LWNNLSDXCAFEMI-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 134.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|