C14H20N2O4 — CID 10016506
benzyl 3-amino-4-(2-methoxyethylamino)-4-oxobutanoate (PubChem CID 10016506) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is benzyl 3-amino-4-(2-methoxyethylamino)-4-oxobutanoate.
| Compound Name | benzyl 3-amino-4-(2-methoxyethylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 10016506 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | benzyl 3-amino-4-(2-methoxyethylamino)-4-oxobutanoate |
| SMILES | COCCNC(=O)C(N)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H20N2O4/c1-19-8-7-16-14(18)12(15)9-13(17)20-10-11-5-3-2-4-6-11/h2-6,12H,7-10,15H2,1H3,(H,16,18) |
| InChIKey | SJZRRULQNOHXKW-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|