C19H24N6O5 — CID 67890720
benzyl 3-[[3,6-diamino-5-(2-methoxyethylcarbamoyl)pyrazine-2-carbonyl]amino]propanoate (PubChem CID 67890720) has the molecular formula C19H24N6O5 and a molecular weight of 416.44 g/mol. Its IUPAC name is benzyl 3-[[3,6-diamino-5-(2-methoxyethylcarbamoyl)pyrazine-2-carbonyl]amino]propanoate.
| Compound Name | benzyl 3-[[3,6-diamino-5-(2-methoxyethylcarbamoyl)pyrazine-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 67890720 |
| Molecular Formula | C19H24N6O5 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | benzyl 3-[[3,6-diamino-5-(2-methoxyethylcarbamoyl)pyrazine-2-carbonyl]amino]propanoate |
| SMILES | COCCNC(=O)c1nc(N)c(C(=O)NCCC(=O)OCc2ccccc2)nc1N |
| InChI | InChI=1S/C19H24N6O5/c1-29-10-9-23-19(28)15-17(21)24-14(16(20)25-15)18(27)22-8-7-13(26)30-11-12-5-3-2-4-6-12/h2-6H,7-11H2,1H3,(H2,20,25)(H2,21,24)(H,22,27)(H,23,28) |
| InChIKey | KSVUFXCTPITXAH-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 171.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|