C17H26N2O8 — CID 163816077
benzyl 3-(2,3,4,5,6-pentahydroxyhexylcarbamoylamino)propanoate (PubChem CID 163816077) has the molecular formula C17H26N2O8 and a molecular weight of 386.40 g/mol. Its IUPAC name is benzyl 3-(2,3,4,5,6-pentahydroxyhexylcarbamoylamino)propanoate.
| Compound Name | benzyl 3-(2,3,4,5,6-pentahydroxyhexylcarbamoylamino)propanoate |
|---|---|
| PubChem CID | 163816077 |
| Molecular Formula | C17H26N2O8 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | benzyl 3-(2,3,4,5,6-pentahydroxyhexylcarbamoylamino)propanoate |
| SMILES | O=C(NCCC(=O)OCc1ccccc1)NCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C17H26N2O8/c20-9-13(22)16(25)15(24)12(21)8-19-17(26)18-7-6-14(23)27-10-11-4-2-1-3-5-11/h1-5,12-13,15-16,20-22,24-25H,6-10H2,(H2,18,19,26) |
| InChIKey | NRLHLPYQSJMXGN-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 168.58 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |