About CID 59270509
CID 59270509 (PubChem CID 59270509) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol.
Molecular Properties
| Compound Name | CID 59270509 |
| PubChem CID | 59270509 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | — |
| SMILES | [CH]CNCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C12H15NO2/c1-2-13-9-8-12(14)15-10-11-6-4-3-5-7-11/h1,3-7,13H,2,8-10H2 |
| InChIKey | CRRVWXILEBQETB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 59270509 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59270509?
The IUPAC name of CID 59270509 (CID 59270509) is not available.
What is the SMILES notation for CID 59270509?
The canonical SMILES for CID 59270509 is [CH]CNCCC(=O)OCc1ccccc1.
What is the InChIKey of CID 59270509?
The InChIKey is CRRVWXILEBQETB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-2-13-9-8-12(14)15-10-11-6-4-3-5-7-11/h1,3-7,13H,2,8-10H2.
What are the key properties of CID 59270509?
CID 59270509 has a molecular weight of 205.26 g/mol, XLogP of 1.42, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59270509 is sourced from PubChem (CID 59270509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).