C19H19F3N2O5 — CID 67827899
benzyl 3-[(3-aminobenzoyl)amino]propanoate;2,2,2-trifluoroacetic acid (PubChem CID 67827899) has the molecular formula C19H19F3N2O5 and a molecular weight of 412.36 g/mol. Its IUPAC name is benzyl 3-[(3-aminobenzoyl)amino]propanoate;2,2,2-trifluoroacetic acid.
| Compound Name | benzyl 3-[(3-aminobenzoyl)amino]propanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67827899 |
| Molecular Formula | C19H19F3N2O5 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | benzyl 3-[(3-aminobenzoyl)amino]propanoate;2,2,2-trifluoroacetic acid |
| SMILES | Nc1cccc(C(=O)NCCC(=O)OCc2ccccc2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H18N2O3.C2HF3O2/c18-15-8-4-7-14(11-15)17(21)19-10-9-16(20)22-12-13-5-2-1-3-6-13;3-2(4,5)1(6)7/h1-8,11H,9-10,12,18H2,(H,19,21);(H,6,7) |
| InChIKey | SIKRRHRZNZYQAG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|