benzyl 3-[(3-aminobenzoyl)amino]propanoate;2,2,2-trifluoroacetic acid

C19H19F3N2O5 — CID 67827899

IUPACbenzyl 3-[(3-aminobenzoyl)amino]propanoate;2,2,2-trifluoroacetic acid
SMILESNc1cccc(C(=O)NCCC(=O)OCc2ccccc2)c1.O=C(O)C(F)(F)F
InChIInChI=1S/C17H18N2O3.C2HF3O2/c18-15-8-4-7-14(11-15)17(21)19-10-9-16(20)22-12-13-5-2-1-3-6-13;3-2(4,5)1(6)7/h1-8,11H,9-10,12,18H2,(H,19,21);(H,6,7)
InChIKeySIKRRHRZNZYQAG-UHFFFAOYSA-N
MW412.36 g/mol
LogP2.77
Rot. Bonds6

About benzyl 3-[(3-aminobenzoyl)amino]propanoate;2,2,2-trifluoroacetic acid

benzyl 3-[(3-aminobenzoyl)amino]propanoate;2,2,2-trifluoroacetic acid (PubChem CID 67827899) has the molecular formula C19H19F3N2O5 and a molecular weight of 412.36 g/mol. Its IUPAC name is benzyl 3-[(3-aminobenzoyl)amino]propanoate;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Namebenzyl 3-[(3-aminobenzoyl)amino]propanoate;2,2,2-trifluoroacetic acid
PubChem CID67827899
Molecular FormulaC19H19F3N2O5
Molecular Weight412.36 g/mol
Exact Mass412.12
IUPAC Namebenzyl 3-[(3-aminobenzoyl)amino]propanoate;2,2,2-trifluoroacetic acid
SMILESNc1cccc(C(=O)NCCC(=O)OCc2ccccc2)c1.O=C(O)C(F)(F)F
InChIInChI=1S/C17H18N2O3.C2HF3O2/c18-15-8-4-7-14(11-15)17(21)19-10-9-16(20)22-12-13-5-2-1-3-6-13;3-2(4,5)1(6)7/h1-8,11H,9-10,12,18H2,(H,19,21);(H,6,7)
InChIKeySIKRRHRZNZYQAG-UHFFFAOYSA-N
XLogP2.77
TPSA118.72 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms29
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500412.36
LogP ≤ 52.77
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze benzyl 3-[(3-aminobenzoyl)amino]propanoate;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 3-[(3-aminobenzoyl)amino]propanoate;2,2,2-trifluoroacetic acid?
The IUPAC name of benzyl 3-[(3-aminobenzoyl)amino]propanoate;2,2,2-trifluoroacetic acid (CID 67827899) is benzyl 3-[(3-aminobenzoyl)amino]propanoate;2,2,2-trifluoroacetic acid.
What is the SMILES notation for benzyl 3-[(3-aminobenzoyl)amino]propanoate;2,2,2-trifluoroacetic acid?
The canonical SMILES for benzyl 3-[(3-aminobenzoyl)amino]propanoate;2,2,2-trifluoroacetic acid is Nc1cccc(C(=O)NCCC(=O)OCc2ccccc2)c1.O=C(O)C(F)(F)F.
What is the InChIKey of benzyl 3-[(3-aminobenzoyl)amino]propanoate;2,2,2-trifluoroacetic acid?
The InChIKey is SIKRRHRZNZYQAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O3.C2HF3O2/c18-15-8-4-7-14(11-15)17(21)19-10-9-16(20)22-12-13-5-2-1-3-6-13;3-2(4,5)1(6)7/h1-8,11H,9-10,12,18H2,(H,19,21);(H,6,7).
What are the key properties of benzyl 3-[(3-aminobenzoyl)amino]propanoate;2,2,2-trifluoroacetic acid?
benzyl 3-[(3-aminobenzoyl)amino]propanoate;2,2,2-trifluoroacetic acid has a molecular weight of 412.36 g/mol, XLogP of 2.77, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-[(3-aminobenzoyl)amino]propanoate;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 67827899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).