C33H31N3O6 — CID 19996339
benzyl 3-[[3-[[3-(phenylmethoxycarbonylaminomethyl)benzoyl]amino]benzoyl]amino]propanoate (PubChem CID 19996339) has the molecular formula C33H31N3O6 and a molecular weight of 565.63 g/mol. Its IUPAC name is benzyl 3-[[3-[[3-(phenylmethoxycarbonylaminomethyl)benzoyl]amino]benzoyl]amino]propanoate.
| Compound Name | benzyl 3-[[3-[[3-(phenylmethoxycarbonylaminomethyl)benzoyl]amino]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 19996339 |
| Molecular Formula | C33H31N3O6 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | benzyl 3-[[3-[[3-(phenylmethoxycarbonylaminomethyl)benzoyl]amino]benzoyl]amino]propanoate |
| SMILES | O=C(CCNC(=O)c1cccc(NC(=O)c2cccc(CNC(=O)OCc3ccccc3)c2)c1)OCc1ccccc1 |
| InChI | InChI=1S/C33H31N3O6/c37-30(41-22-24-9-3-1-4-10-24)17-18-34-31(38)28-15-8-16-29(20-28)36-32(39)27-14-7-13-26(19-27)21-35-33(40)42-23-25-11-5-2-6-12-25/h1-16,19-20H,17-18,21-23H2,(H,34,38)(H,35,40)(H,36,39) |
| InChIKey | OLHGLWJJWOKCGF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |