C29H39N3O6 — CID 19996313
benzyl 3-[[3-[7-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoylamino]benzoyl]amino]propanoate (PubChem CID 19996313) has the molecular formula C29H39N3O6 and a molecular weight of 525.65 g/mol. Its IUPAC name is benzyl 3-[[3-[7-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoylamino]benzoyl]amino]propanoate.
| Compound Name | benzyl 3-[[3-[7-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoylamino]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 19996313 |
| Molecular Formula | C29H39N3O6 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | benzyl 3-[[3-[7-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoylamino]benzoyl]amino]propanoate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCC(=O)Nc1cccc(C(=O)NCCC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C29H39N3O6/c1-29(2,3)38-28(36)31-18-10-5-4-9-16-25(33)32-24-15-11-14-23(20-24)27(35)30-19-17-26(34)37-21-22-12-7-6-8-13-22/h6-8,11-15,20H,4-5,9-10,16-19,21H2,1-3H3,(H,30,35)(H,31,36)(H,32,33) |
| InChIKey | MEYJBNOMCOVZSK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|