C34H32N4O6 — CID 54178877
benzyl 3-[[3-[[[4-(N'-phenylmethoxycarbonylcarbamimidoyl)benzoyl]amino]methyl]benzoyl]amino]propanoate (PubChem CID 54178877) has the molecular formula C34H32N4O6 and a molecular weight of 592.65 g/mol. Its IUPAC name is benzyl 3-[[3-[[[4-(N'-phenylmethoxycarbonylcarbamimidoyl)benzoyl]amino]methyl]benzoyl]amino]propanoate.
| Compound Name | benzyl 3-[[3-[[[4-(N'-phenylmethoxycarbonylcarbamimidoyl)benzoyl]amino]methyl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 54178877 |
| Molecular Formula | C34H32N4O6 |
| Molecular Weight | 592.65 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | benzyl 3-[[3-[[[4-(N'-phenylmethoxycarbonylcarbamimidoyl)benzoyl]amino]methyl]benzoyl]amino]propanoate |
| SMILES | NC(=NC(=O)OCc1ccccc1)c1ccc(C(=O)NCc2cccc(C(=O)NCCC(=O)OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C34H32N4O6/c35-31(38-34(42)44-23-25-10-5-2-6-11-25)27-14-16-28(17-15-27)32(40)37-21-26-12-7-13-29(20-26)33(41)36-19-18-30(39)43-22-24-8-3-1-4-9-24/h1-17,20H,18-19,21-23H2,(H,36,41)(H,37,40)(H2,35,38,42) |
| InChIKey | PAJQYGWPEHDJNV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 149.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.65 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|