C29H27ClN4O3 — CID 75994496
benzyl N-[amino-[4-[[[1-(4-chlorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]methyl]phenyl]methylidene]carbamate (PubChem CID 75994496) has the molecular formula C29H27ClN4O3 and a molecular weight of 515.01 g/mol. Its IUPAC name is benzyl N-[amino-[4-[[[1-(4-chlorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]methyl]phenyl]methylidene]carbamate.
| Compound Name | benzyl N-[amino-[4-[[[1-(4-chlorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]methyl]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 75994496 |
| Molecular Formula | C29H27ClN4O3 |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | benzyl N-[amino-[4-[[[1-(4-chlorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]methyl]phenyl]methylidene]carbamate |
| SMILES | Cc1cc(C(=O)NCc2ccc(C(N)=NC(=O)OCc3ccccc3)cc2)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H27ClN4O3/c1-19-16-26(20(2)34(19)25-14-12-24(30)13-15-25)28(35)32-17-21-8-10-23(11-9-21)27(31)33-29(36)37-18-22-6-4-3-5-7-22/h3-16H,17-18H2,1-2H3,(H,32,35)(H2,31,33,36) |
| InChIKey | DMLZSZXCHLHJIB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 98.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|