C23H22LiN3O5 — CID 23698505
lithium 2-[[4-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]phenyl]methylcarbamoyl]cyclopent-2-ene-1-carboxylate (PubChem CID 23698505) has the molecular formula C23H22LiN3O5 and a molecular weight of 427.39 g/mol. Its IUPAC name is lithium 2-[[4-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]phenyl]methylcarbamoyl]cyclopent-2-ene-1-carboxylate.
| Compound Name | lithium 2-[[4-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]phenyl]methylcarbamoyl]cyclopent-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 23698505 |
| Molecular Formula | C23H22LiN3O5 |
| Molecular Weight | 427.39 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | lithium 2-[[4-[(E)-N'-phenylmethoxycarbonylcarbamimidoyl]phenyl]methylcarbamoyl]cyclopent-2-ene-1-carboxylate |
| SMILES | N/C(=N/C(=O)OCc1ccccc1)c1ccc(CNC(=O)C2=CCCC2C(=O)[O-])cc1.[Li+] |
| InChI | InChI=1S/C23H23N3O5.Li/c24-20(26-23(30)31-14-16-5-2-1-3-6-16)17-11-9-15(10-12-17)13-25-21(27)18-7-4-8-19(18)22(28)29;/h1-3,5-7,9-12,19H,4,8,13-14H2,(H,25,27)(H,28,29)(H2,24,26,30);/q;+1/p-1 |
| InChIKey | AMRWWFNEULRPTQ-UHFFFAOYSA-M |
| XLogP | -1.56 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.39 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|