C34H36N4O4 — CID 10962783
benzyl (NE)-N-[amino-[4-[[[2-[2-methoxy-6-phenyl-3-(propan-2-ylamino)phenyl]acetyl]amino]methyl]phenyl]methylidene]carbamate (PubChem CID 10962783) has the molecular formula C34H36N4O4 and a molecular weight of 564.69 g/mol. Its IUPAC name is benzyl (NE)-N-[amino-[4-[[[2-[2-methoxy-6-phenyl-3-(propan-2-ylamino)phenyl]acetyl]amino]methyl]phenyl]methylidene]carbamate.
| Compound Name | benzyl (NE)-N-[amino-[4-[[[2-[2-methoxy-6-phenyl-3-(propan-2-ylamino)phenyl]acetyl]amino]methyl]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 10962783 |
| Molecular Formula | C34H36N4O4 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | benzyl (NE)-N-[amino-[4-[[[2-[2-methoxy-6-phenyl-3-(propan-2-ylamino)phenyl]acetyl]amino]methyl]phenyl]methylidene]carbamate |
| SMILES | COc1c(NC(C)C)ccc(-c2ccccc2)c1CC(=O)NCc1ccc(/C(N)=N\C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C34H36N4O4/c1-23(2)37-30-19-18-28(26-12-8-5-9-13-26)29(32(30)41-3)20-31(39)36-21-24-14-16-27(17-15-24)33(35)38-34(40)42-22-25-10-6-4-7-11-25/h4-19,23,37H,20-22H2,1-3H3,(H,36,39)(H2,35,38,40) |
| InChIKey | YLSIBUGMANBEIV-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|