C34H36ClN7O6 — CID 57487816
ethyl 3-amino-5-[3-chloro-6-oxo-1-[2-oxo-2-[[4-[(Z)-N'-phenylmethoxycarbonylcarbamimidoyl]phenyl]methylamino]ethyl]-5-(propan-2-ylamino)pyrazin-2-yl]benzoate (PubChem CID 57487816) has the molecular formula C34H36ClN7O6 and a molecular weight of 674.16 g/mol. Its IUPAC name is ethyl 3-amino-5-[3-chloro-6-oxo-1-[2-oxo-2-[[4-[(Z)-N'-phenylmethoxycarbonylcarbamimidoyl]phenyl]methylamino]ethyl]-5-(propan-2-ylamino)pyrazin-2-yl]benzoate.
| Compound Name | ethyl 3-amino-5-[3-chloro-6-oxo-1-[2-oxo-2-[[4-[(Z)-N'-phenylmethoxycarbonylcarbamimidoyl]phenyl]methylamino]ethyl]-5-(propan-2-ylamino)pyrazin-2-yl]benzoate |
|---|---|
| PubChem CID | 57487816 |
| Molecular Formula | C34H36ClN7O6 |
| Molecular Weight | 674.16 g/mol |
| Exact Mass | 673.24 |
| IUPAC Name | ethyl 3-amino-5-[3-chloro-6-oxo-1-[2-oxo-2-[[4-[(Z)-N'-phenylmethoxycarbonylcarbamimidoyl]phenyl]methylamino]ethyl]-5-(propan-2-ylamino)pyrazin-2-yl]benzoate |
| SMILES | CCOC(=O)c1cc(N)cc(-c2c(Cl)nc(NC(C)C)c(=O)n2CC(=O)NCc2ccc(/C(N)=N/C(=O)OCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C34H36ClN7O6/c1-4-47-33(45)25-14-24(15-26(36)16-25)28-29(35)40-31(39-20(2)3)32(44)42(28)18-27(43)38-17-21-10-12-23(13-11-21)30(37)41-34(46)48-19-22-8-6-5-7-9-22/h5-16,20H,4,17-19,36H2,1-3H3,(H,38,43)(H,39,40)(H2,37,41,46) |
| InChIKey | FPVXEYSUWUQRQY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 193.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.16 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|