C29H40N7O6P — CID 142232349
methyl 3-amino-5-[1-[2-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methylamino]-2-oxoethyl]-6-oxo-5-(propan-2-ylamino)pyrazin-2-yl]benzoate;methylphosphane;propan-2-one (PubChem CID 142232349) has the molecular formula C29H40N7O6P and a molecular weight of 613.66 g/mol. Its IUPAC name is methyl 3-amino-5-[1-[2-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methylamino]-2-oxoethyl]-6-oxo-5-(propan-2-ylamino)pyrazin-2-yl]benzoate;methylphosphane;propan-2-one.
| Compound Name | methyl 3-amino-5-[1-[2-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methylamino]-2-oxoethyl]-6-oxo-5-(propan-2-ylamino)pyrazin-2-yl]benzoate;methylphosphane;propan-2-one |
|---|---|
| PubChem CID | 142232349 |
| Molecular Formula | C29H40N7O6P |
| Molecular Weight | 613.66 g/mol |
| Exact Mass | 613.28 |
| IUPAC Name | methyl 3-amino-5-[1-[2-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]methylamino]-2-oxoethyl]-6-oxo-5-(propan-2-ylamino)pyrazin-2-yl]benzoate;methylphosphane;propan-2-one |
| SMILES | CC(C)=O.COC(=O)c1cc(N)cc(-c2cnc(NC(C)C)c(=O)n2CC(=O)NCc2ccc(/C(N)=N/O)cc2)c1.CP |
| InChI | InChI=1S/C25H29N7O5.C3H6O.CH5P/c1-14(2)30-23-24(34)32(13-21(33)28-11-15-4-6-16(7-5-15)22(27)31-36)20(12-29-23)17-8-18(25(35)37-3)10-19(26)9-17;1-3(2)4;1-2/h4-10,12,14,36H,11,13,26H2,1-3H3,(H2,27,31)(H,28,33)(H,29,30);1-2H3;2H2,1H3 |
| InChIKey | ZWWPWPRSESBFBO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 204.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.66 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|