C35H41N7O4S — CID 72646114
benzyl N-[amino-[4-[[[2-[6-[3-amino-5-(2-methylpropylsulfanyl)phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]carbamate (PubChem CID 72646114) has the molecular formula C35H41N7O4S and a molecular weight of 655.83 g/mol. Its IUPAC name is benzyl N-[amino-[4-[[[2-[6-[3-amino-5-(2-methylpropylsulfanyl)phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]carbamate.
| Compound Name | benzyl N-[amino-[4-[[[2-[6-[3-amino-5-(2-methylpropylsulfanyl)phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 72646114 |
| Molecular Formula | C35H41N7O4S |
| Molecular Weight | 655.83 g/mol |
| Exact Mass | 655.29 |
| IUPAC Name | benzyl N-[amino-[4-[[[2-[6-[3-amino-5-(2-methylpropylsulfanyl)phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]carbamate |
| SMILES | CC(C)CSc1cc(N)cc(-c2cnc(NC(C)C)c(=O)n2CC(=O)NCc2ccc(C(N)=NC(=O)OCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C35H41N7O4S/c1-22(2)21-47-29-15-27(14-28(36)16-29)30-18-39-33(40-23(3)4)34(44)42(30)19-31(43)38-17-24-10-12-26(13-11-24)32(37)41-35(45)46-20-25-8-6-5-7-9-25/h5-16,18,22-23H,17,19-21,36H2,1-4H3,(H,38,43)(H,39,40)(H2,37,41,45) |
| InChIKey | KOCXYOCGWBISIS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 166.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.83 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|