C37H37N7O4 — CID 90808760
benzyl N-[4-[[[2-[6-(3-amino-5-phenylphenyl)-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]-N-methanimidoylcarbamate (PubChem CID 90808760) has the molecular formula C37H37N7O4 and a molecular weight of 643.75 g/mol. Its IUPAC name is benzyl N-[4-[[[2-[6-(3-amino-5-phenylphenyl)-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]-N-methanimidoylcarbamate.
| Compound Name | benzyl N-[4-[[[2-[6-(3-amino-5-phenylphenyl)-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]-N-methanimidoylcarbamate |
|---|---|
| PubChem CID | 90808760 |
| Molecular Formula | C37H37N7O4 |
| Molecular Weight | 643.75 g/mol |
| Exact Mass | 643.29 |
| IUPAC Name | benzyl N-[4-[[[2-[6-(3-amino-5-phenylphenyl)-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]-N-methanimidoylcarbamate |
| SMILES | [H]/N=C/N(C(=O)OCc1ccccc1)c1ccc(CNC(=O)Cn2c(-c3cc(N)cc(-c4ccccc4)c3)cnc(NC(C)C)c2=O)cc1 |
| InChI | InChI=1S/C37H37N7O4/c1-25(2)42-35-36(46)43(33(21-41-35)30-17-29(18-31(39)19-30)28-11-7-4-8-12-28)22-34(45)40-20-26-13-15-32(16-14-26)44(24-38)37(47)48-23-27-9-5-3-6-10-27/h3-19,21,24-25,38H,20,22-23,39H2,1-2H3,(H,40,45)(H,41,42)/b38-24+ |
| InChIKey | PLYQRQKIXAANBN-RQXXSLPSSA-N |
| XLogP | 6.05 |
| TPSA | 155.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.75 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|