C40H41N7O4 — CID 90704243
benzyl N-[4-[[[2-[6-[3-amino-5-(3-phenylprop-1-enyl)phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]-N-methanimidoylcarbamate (PubChem CID 90704243) has the molecular formula C40H41N7O4 and a molecular weight of 683.81 g/mol. Its IUPAC name is benzyl N-[4-[[[2-[6-[3-amino-5-(3-phenylprop-1-enyl)phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]-N-methanimidoylcarbamate.
| Compound Name | benzyl N-[4-[[[2-[6-[3-amino-5-(3-phenylprop-1-enyl)phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]-N-methanimidoylcarbamate |
|---|---|
| PubChem CID | 90704243 |
| Molecular Formula | C40H41N7O4 |
| Molecular Weight | 683.81 g/mol |
| Exact Mass | 683.32 |
| IUPAC Name | benzyl N-[4-[[[2-[6-[3-amino-5-(3-phenylprop-1-enyl)phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]-N-methanimidoylcarbamate |
| SMILES | [H]/N=C/N(C(=O)OCc1ccccc1)c1ccc(CNC(=O)Cn2c(-c3cc(N)cc(C=CCc4ccccc4)c3)cnc(NC(C)C)c2=O)cc1 |
| InChI | InChI=1S/C40H41N7O4/c1-28(2)45-38-39(49)46(36(24-44-38)33-20-32(21-34(42)22-33)15-9-14-29-10-5-3-6-11-29)25-37(48)43-23-30-16-18-35(19-17-30)47(27-41)40(50)51-26-31-12-7-4-8-13-31/h3-13,15-22,24,27-28,41H,14,23,25-26,42H2,1-2H3,(H,43,48)(H,44,45)/b15-9?,41-27+ |
| InChIKey | QAYSJAIAQKQMNF-UOJQSSSESA-N |
| XLogP | 6.64 |
| TPSA | 155.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.81 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|