C35H35F7N8O7 — CID 159912022
3-amino-5-[1-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-6-oxo-5-(propan-2-ylamino)pyrazin-2-yl]-N-[(3-fluorophenyl)methyl]benzamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 159912022) has the molecular formula C35H35F7N8O7 and a molecular weight of 812.70 g/mol. Its IUPAC name is 3-amino-5-[1-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-6-oxo-5-(propan-2-ylamino)pyrazin-2-yl]-N-[(3-fluorophenyl)methyl]benzamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 3-amino-5-[1-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-6-oxo-5-(propan-2-ylamino)pyrazin-2-yl]-N-[(3-fluorophenyl)methyl]benzamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 159912022 |
| Molecular Formula | C35H35F7N8O7 |
| Molecular Weight | 812.70 g/mol |
| Exact Mass | 812.25 |
| IUPAC Name | 3-amino-5-[1-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-6-oxo-5-(propan-2-ylamino)pyrazin-2-yl]-N-[(3-fluorophenyl)methyl]benzamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(CNC(=O)Cn2c(-c3cc(N)cc(C(=O)NCc4cccc(F)c4)c3)cnc(NC(C)C)c2=O)cc1 |
| InChI | InChI=1S/C31H33FN8O3.2C2HF3O2/c1-18(2)39-29-31(43)40(17-27(41)36-14-19-6-8-21(9-7-19)28(34)35)26(16-37-29)22-11-23(13-25(33)12-22)30(42)38-15-20-4-3-5-24(32)10-20;2*3-2(4,5)1(6)7/h3-13,16,18H,14-15,17,33H2,1-2H3,(H3,34,35)(H,36,41)(H,37,39)(H,38,42);2*(H,6,7) |
| InChIKey | LHSHXRXERJJICX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 255.61 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.70 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|