C30H40N8O3 — CID 142232535
3-amino-N-[(2S)-butan-2-yl]-5-[1-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-5-(3-methylbutan-2-ylamino)-6-oxopyrazin-2-yl]benzamide (PubChem CID 142232535) has the molecular formula C30H40N8O3 and a molecular weight of 560.70 g/mol. Its IUPAC name is 3-amino-N-[(2S)-butan-2-yl]-5-[1-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-5-(3-methylbutan-2-ylamino)-6-oxopyrazin-2-yl]benzamide.
| Compound Name | 3-amino-N-[(2S)-butan-2-yl]-5-[1-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-5-(3-methylbutan-2-ylamino)-6-oxopyrazin-2-yl]benzamide |
|---|---|
| PubChem CID | 142232535 |
| Molecular Formula | C30H40N8O3 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.32 |
| IUPAC Name | 3-amino-N-[(2S)-butan-2-yl]-5-[1-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-5-(3-methylbutan-2-ylamino)-6-oxopyrazin-2-yl]benzamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)Cn2c(-c3cc(N)cc(C(=O)N[C@@H](C)CC)c3)cnc(NC(C)C(C)C)c2=O)cc1 |
| InChI | InChI=1S/C30H40N8O3/c1-6-18(4)36-29(40)23-11-22(12-24(31)13-23)25-15-35-28(37-19(5)17(2)3)30(41)38(25)16-26(39)34-14-20-7-9-21(10-8-20)27(32)33/h7-13,15,17-19H,6,14,16,31H2,1-5H3,(H3,32,33)(H,34,39)(H,35,37)(H,36,40)/t18-,19?/m0/s1 |
| InChIKey | KPGUJNWLKFIGTE-OYKVQYDMSA-N |
| XLogP | 3.08 |
| TPSA | 181.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|