C35H40N8O5 — CID 67564457
benzyl N-[amino-[4-[[[2-[6-[3-amino-5-[[(2R)-butan-2-yl]carbamoyl]phenyl]-3-(ethylamino)-2-oxopyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]carbamate (PubChem CID 67564457) has the molecular formula C35H40N8O5 and a molecular weight of 652.76 g/mol. Its IUPAC name is benzyl N-[amino-[4-[[[2-[6-[3-amino-5-[[(2R)-butan-2-yl]carbamoyl]phenyl]-3-(ethylamino)-2-oxopyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]carbamate.
| Compound Name | benzyl N-[amino-[4-[[[2-[6-[3-amino-5-[[(2R)-butan-2-yl]carbamoyl]phenyl]-3-(ethylamino)-2-oxopyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 67564457 |
| Molecular Formula | C35H40N8O5 |
| Molecular Weight | 652.76 g/mol |
| Exact Mass | 652.31 |
| IUPAC Name | benzyl N-[amino-[4-[[[2-[6-[3-amino-5-[[(2R)-butan-2-yl]carbamoyl]phenyl]-3-(ethylamino)-2-oxopyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]carbamate |
| SMILES | CCNc1ncc(-c2cc(N)cc(C(=O)N[C@H](C)CC)c2)n(CC(=O)NCc2ccc(C(N)=NC(=O)OCc3ccccc3)cc2)c1=O |
| InChI | InChI=1S/C35H40N8O5/c1-4-22(3)41-33(45)27-15-26(16-28(36)17-27)29-19-40-32(38-5-2)34(46)43(29)20-30(44)39-18-23-11-13-25(14-12-23)31(37)42-35(47)48-21-24-9-7-6-8-10-24/h6-17,19,22H,4-5,18,20-21,36H2,1-3H3,(H,38,40)(H,39,44)(H,41,45)(H2,37,42,47)/t22-/m1/s1 |
| InChIKey | NHBDYKVKVJTCHP-JOCHJYFZSA-N |
| XLogP | 3.81 |
| TPSA | 195.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.76 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|