C30H38N8O5 — CID 173225171
[4-[[[2-[6-[3-amino-5-[[(2R)-butan-2-yl]carbamoyl]phenyl]-3-(tert-butylamino)-2-oxopyrazin-1-yl]acetyl]amino]methyl]benzenecarboximidoyl]carbamic acid (PubChem CID 173225171) has the molecular formula C30H38N8O5 and a molecular weight of 590.69 g/mol. Its IUPAC name is [4-[[[2-[6-[3-amino-5-[[(2R)-butan-2-yl]carbamoyl]phenyl]-3-(tert-butylamino)-2-oxopyrazin-1-yl]acetyl]amino]methyl]benzenecarboximidoyl]carbamic acid.
| Compound Name | [4-[[[2-[6-[3-amino-5-[[(2R)-butan-2-yl]carbamoyl]phenyl]-3-(tert-butylamino)-2-oxopyrazin-1-yl]acetyl]amino]methyl]benzenecarboximidoyl]carbamic acid |
|---|---|
| PubChem CID | 173225171 |
| Molecular Formula | C30H38N8O5 |
| Molecular Weight | 590.69 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | [4-[[[2-[6-[3-amino-5-[[(2R)-butan-2-yl]carbamoyl]phenyl]-3-(tert-butylamino)-2-oxopyrazin-1-yl]acetyl]amino]methyl]benzenecarboximidoyl]carbamic acid |
| SMILES | [H]/N=C(\NC(=O)O)c1ccc(CNC(=O)Cn2c(-c3cc(N)cc(C(=O)N[C@H](C)CC)c3)cnc(NC(C)(C)C)c2=O)cc1 |
| InChI | InChI=1S/C30H38N8O5/c1-6-17(2)35-27(40)21-11-20(12-22(31)13-21)23-15-34-26(37-30(3,4)5)28(41)38(23)16-24(39)33-14-18-7-9-19(10-8-18)25(32)36-29(42)43/h7-13,15,17H,6,14,16,31H2,1-5H3,(H2,32,36)(H,33,39)(H,34,37)(H,35,40)(H,42,43)/t17-/m1/s1 |
| InChIKey | YYULZGGWTNGJJN-QGZVFWFLSA-N |
| XLogP | 3.14 |
| TPSA | 204.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.69 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|