C31H40N8O5 — CID 72644198
[[amino-[4-[[[2-[6-[3-amino-5-(propan-2-ylcarbamoyl)phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]amino] 2-methylpropanoate (PubChem CID 72644198) has the molecular formula C31H40N8O5 and a molecular weight of 604.71 g/mol. Its IUPAC name is [[amino-[4-[[[2-[6-[3-amino-5-(propan-2-ylcarbamoyl)phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]amino] 2-methylpropanoate.
| Compound Name | [[amino-[4-[[[2-[6-[3-amino-5-(propan-2-ylcarbamoyl)phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]amino] 2-methylpropanoate |
|---|---|
| PubChem CID | 72644198 |
| Molecular Formula | C31H40N8O5 |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.31 |
| IUPAC Name | [[amino-[4-[[[2-[6-[3-amino-5-(propan-2-ylcarbamoyl)phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]amino] 2-methylpropanoate |
| SMILES | CC(C)NC(=O)c1cc(N)cc(-c2cnc(NC(C)C)c(=O)n2CC(=O)NCc2ccc(C(N)=NOC(=O)C(C)C)cc2)c1 |
| InChI | InChI=1S/C31H40N8O5/c1-17(2)31(43)44-38-27(33)21-9-7-20(8-10-21)14-34-26(40)16-39-25(15-35-28(30(39)42)36-18(3)4)22-11-23(13-24(32)12-22)29(41)37-19(5)6/h7-13,15,17-19H,14,16,32H2,1-6H3,(H2,33,38)(H,34,40)(H,35,36)(H,37,41) |
| InChIKey | WGXSLEKKTBMHRV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 195.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|