C31H34FN8O3+ — CID 142232655
[amino-[4-[[[2-[6-[3-amino-5-[(3-fluorophenyl)methylcarbamoyl]phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]azanium (PubChem CID 142232655) has the molecular formula C31H34FN8O3+ and a molecular weight of 585.66 g/mol. Its IUPAC name is [amino-[4-[[[2-[6-[3-amino-5-[(3-fluorophenyl)methylcarbamoyl]phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]azanium.
| Compound Name | [amino-[4-[[[2-[6-[3-amino-5-[(3-fluorophenyl)methylcarbamoyl]phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]azanium |
|---|---|
| PubChem CID | 142232655 |
| Molecular Formula | C31H34FN8O3+ |
| Molecular Weight | 585.66 g/mol |
| Exact Mass | 585.27 |
| IUPAC Name | [amino-[4-[[[2-[6-[3-amino-5-[(3-fluorophenyl)methylcarbamoyl]phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]azanium |
| SMILES | CC(C)Nc1ncc(-c2cc(N)cc(C(=O)NCc3cccc(F)c3)c2)n(CC(=O)NCc2ccc(C(N)=[NH2+])cc2)c1=O |
| InChI | InChI=1S/C31H33FN8O3/c1-18(2)39-29-31(43)40(17-27(41)36-14-19-6-8-21(9-7-19)28(34)35)26(16-37-29)22-11-23(13-25(33)12-22)30(42)38-15-20-4-3-5-24(32)10-20/h3-13,16,18H,14-15,17,33H2,1-2H3,(H3,34,35)(H,36,41)(H,37,39)(H,38,42)/p+1 |
| InChIKey | NXHHTZYILQZZLE-UHFFFAOYSA-O |
| XLogP | 1.16 |
| TPSA | 182.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.66 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|