C25H28F3N7O5S — CID 72644251
[[amino-[4-[[[2-[6-[3-amino-5-(trifluoromethyl)phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]amino] methanesulfonate (PubChem CID 72644251) has the molecular formula C25H28F3N7O5S and a molecular weight of 595.60 g/mol. Its IUPAC name is [[amino-[4-[[[2-[6-[3-amino-5-(trifluoromethyl)phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]amino] methanesulfonate.
| Compound Name | [[amino-[4-[[[2-[6-[3-amino-5-(trifluoromethyl)phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]amino] methanesulfonate |
|---|---|
| PubChem CID | 72644251 |
| Molecular Formula | C25H28F3N7O5S |
| Molecular Weight | 595.60 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | [[amino-[4-[[[2-[6-[3-amino-5-(trifluoromethyl)phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]amino] methanesulfonate |
| SMILES | CC(C)Nc1ncc(-c2cc(N)cc(C(F)(F)F)c2)n(CC(=O)NCc2ccc(C(N)=NOS(C)(=O)=O)cc2)c1=O |
| InChI | InChI=1S/C25H28F3N7O5S/c1-14(2)33-23-24(37)35(20(12-32-23)17-8-18(25(26,27)28)10-19(29)9-17)13-21(36)31-11-15-4-6-16(7-5-15)22(30)34-40-41(3,38)39/h4-10,12,14H,11,13,29H2,1-3H3,(H2,30,34)(H,31,36)(H,32,33) |
| InChIKey | XXSGALWIJCSEAQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 183.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.60 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|