C36H42N8O5 — CID 67564126
benzyl N-[amino-[4-[[[2-[6-[3-amino-5-[[(2S)-butan-2-yl]carbamoyl]phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]carbamate (PubChem CID 67564126) has the molecular formula C36H42N8O5 and a molecular weight of 666.78 g/mol. Its IUPAC name is benzyl N-[amino-[4-[[[2-[6-[3-amino-5-[[(2S)-butan-2-yl]carbamoyl]phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]carbamate.
| Compound Name | benzyl N-[amino-[4-[[[2-[6-[3-amino-5-[[(2S)-butan-2-yl]carbamoyl]phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 67564126 |
| Molecular Formula | C36H42N8O5 |
| Molecular Weight | 666.78 g/mol |
| Exact Mass | 666.33 |
| IUPAC Name | benzyl N-[amino-[4-[[[2-[6-[3-amino-5-[[(2S)-butan-2-yl]carbamoyl]phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]carbamate |
| SMILES | CC[C@H](C)NC(=O)c1cc(N)cc(-c2cnc(NC(C)C)c(=O)n2CC(=O)NCc2ccc(C(N)=NC(=O)OCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C36H42N8O5/c1-5-23(4)42-34(46)28-15-27(16-29(37)17-28)30-19-40-33(41-22(2)3)35(47)44(30)20-31(45)39-18-24-11-13-26(14-12-24)32(38)43-36(48)49-21-25-9-7-6-8-10-25/h6-17,19,22-23H,5,18,20-21,37H2,1-4H3,(H,39,45)(H,40,41)(H,42,46)(H2,38,43,48)/t23-/m0/s1 |
| InChIKey | MEYAIQIVECGCDW-QHCPKHFHSA-N |
| XLogP | 4.20 |
| TPSA | 195.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.78 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|