C36H40N8O6 — CID 67564114
2-(dimethylamino)ethyl 3-amino-5-[5-(cyclopropylamino)-6-oxo-1-[2-oxo-2-[[4-(N'-phenylmethoxycarbonylcarbamimidoyl)phenyl]methylamino]ethyl]pyrazin-2-yl]benzoate (PubChem CID 67564114) has the molecular formula C36H40N8O6 and a molecular weight of 680.77 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 3-amino-5-[5-(cyclopropylamino)-6-oxo-1-[2-oxo-2-[[4-(N'-phenylmethoxycarbonylcarbamimidoyl)phenyl]methylamino]ethyl]pyrazin-2-yl]benzoate.
| Compound Name | 2-(dimethylamino)ethyl 3-amino-5-[5-(cyclopropylamino)-6-oxo-1-[2-oxo-2-[[4-(N'-phenylmethoxycarbonylcarbamimidoyl)phenyl]methylamino]ethyl]pyrazin-2-yl]benzoate |
|---|---|
| PubChem CID | 67564114 |
| Molecular Formula | C36H40N8O6 |
| Molecular Weight | 680.77 g/mol |
| Exact Mass | 680.31 |
| IUPAC Name | 2-(dimethylamino)ethyl 3-amino-5-[5-(cyclopropylamino)-6-oxo-1-[2-oxo-2-[[4-(N'-phenylmethoxycarbonylcarbamimidoyl)phenyl]methylamino]ethyl]pyrazin-2-yl]benzoate |
| SMILES | CN(C)CCOC(=O)c1cc(N)cc(-c2cnc(NC3CC3)c(=O)n2CC(=O)NCc2ccc(C(N)=NC(=O)OCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C36H40N8O6/c1-43(2)14-15-49-35(47)27-16-26(17-28(37)18-27)30-20-40-33(41-29-12-13-29)34(46)44(30)21-31(45)39-19-23-8-10-25(11-9-23)32(38)42-36(48)50-22-24-6-4-3-5-7-24/h3-11,16-18,20,29H,12-15,19,21-22,37H2,1-2H3,(H,39,45)(H,40,41)(H2,38,42,48) |
| InChIKey | HSJZKLZDQZGOIO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 196.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.77 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|