C33H33N7O7 — CID 72646137
benzyl N-[amino-[4-[[[2-[3-(cyclopropylamino)-6-(3-ethoxy-5-nitrophenyl)-2-oxopyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]carbamate (PubChem CID 72646137) has the molecular formula C33H33N7O7 and a molecular weight of 639.67 g/mol. Its IUPAC name is benzyl N-[amino-[4-[[[2-[3-(cyclopropylamino)-6-(3-ethoxy-5-nitrophenyl)-2-oxopyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]carbamate.
| Compound Name | benzyl N-[amino-[4-[[[2-[3-(cyclopropylamino)-6-(3-ethoxy-5-nitrophenyl)-2-oxopyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 72646137 |
| Molecular Formula | C33H33N7O7 |
| Molecular Weight | 639.67 g/mol |
| Exact Mass | 639.24 |
| IUPAC Name | benzyl N-[amino-[4-[[[2-[3-(cyclopropylamino)-6-(3-ethoxy-5-nitrophenyl)-2-oxopyrazin-1-yl]acetyl]amino]methyl]phenyl]methylidene]carbamate |
| SMILES | CCOc1cc(-c2cnc(NC3CC3)c(=O)n2CC(=O)NCc2ccc(C(N)=NC(=O)OCc3ccccc3)cc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C33H33N7O7/c1-2-46-27-15-24(14-26(16-27)40(44)45)28-18-36-31(37-25-12-13-25)32(42)39(28)19-29(41)35-17-21-8-10-23(11-9-21)30(34)38-33(43)47-20-22-6-4-3-5-7-22/h3-11,14-16,18,25H,2,12-13,17,19-20H2,1H3,(H,35,41)(H,36,37)(H2,34,38,43) |
| InChIKey | MIXXDQAFSZRKOT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 193.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.67 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|