C25H26N10O4 — CID 90833323
N-[(4-ethanimidoylphenyl)methyl]-2-[6-[3-nitro-5-(2H-tetrazol-5-yl)phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetamide (PubChem CID 90833323) has the molecular formula C25H26N10O4 and a molecular weight of 530.55 g/mol. Its IUPAC name is N-[(4-ethanimidoylphenyl)methyl]-2-[6-[3-nitro-5-(2H-tetrazol-5-yl)phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetamide.
| Compound Name | N-[(4-ethanimidoylphenyl)methyl]-2-[6-[3-nitro-5-(2H-tetrazol-5-yl)phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetamide |
|---|---|
| PubChem CID | 90833323 |
| Molecular Formula | C25H26N10O4 |
| Molecular Weight | 530.55 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | N-[(4-ethanimidoylphenyl)methyl]-2-[6-[3-nitro-5-(2H-tetrazol-5-yl)phenyl]-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetamide |
| SMILES | [H]/N=C(\C)c1ccc(CNC(=O)Cn2c(-c3cc(-c4nn[nH]n4)cc([N+](=O)[O-])c3)cnc(NC(C)C)c2=O)cc1 |
| InChI | InChI=1S/C25H26N10O4/c1-14(2)29-24-25(37)34(13-22(36)27-11-16-4-6-17(7-5-16)15(3)26)21(12-28-24)18-8-19(23-30-32-33-31-23)10-20(9-18)35(38)39/h4-10,12,14,26H,11,13H2,1-3H3,(H,27,36)(H,28,29)(H,30,31,32,33)/b26-15+ |
| InChIKey | POVGUVRWWQRQNH-CVKSISIWSA-N |
| XLogP | 2.52 |
| TPSA | 197.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.55 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|