C35H49N7O6 — CID 142232614
[3-(3-methoxy-3-methylbutoxy)-3-methylbutyl] 3-amino-5-[1-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-6-oxo-5-(propan-2-ylamino)pyrazin-2-yl]benzoate (PubChem CID 142232614) has the molecular formula C35H49N7O6 and a molecular weight of 663.82 g/mol. Its IUPAC name is [3-(3-methoxy-3-methylbutoxy)-3-methylbutyl] 3-amino-5-[1-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-6-oxo-5-(propan-2-ylamino)pyrazin-2-yl]benzoate.
| Compound Name | [3-(3-methoxy-3-methylbutoxy)-3-methylbutyl] 3-amino-5-[1-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-6-oxo-5-(propan-2-ylamino)pyrazin-2-yl]benzoate |
|---|---|
| PubChem CID | 142232614 |
| Molecular Formula | C35H49N7O6 |
| Molecular Weight | 663.82 g/mol |
| Exact Mass | 663.37 |
| IUPAC Name | [3-(3-methoxy-3-methylbutoxy)-3-methylbutyl] 3-amino-5-[1-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-6-oxo-5-(propan-2-ylamino)pyrazin-2-yl]benzoate |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)Cn2c(-c3cc(N)cc(C(=O)OCCC(C)(C)OCCC(C)(C)OC)c3)cnc(NC(C)C)c2=O)cc1 |
| InChI | InChI=1S/C35H49N7O6/c1-22(2)41-31-32(44)42(21-29(43)39-19-23-8-10-24(11-9-23)30(37)38)28(20-40-31)25-16-26(18-27(36)17-25)33(45)47-14-12-35(5,6)48-15-13-34(3,4)46-7/h8-11,16-18,20,22H,12-15,19,21,36H2,1-7H3,(H3,37,38)(H,39,43)(H,40,41) |
| InChIKey | VZWULIBGHQKIRZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 196.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.82 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|