C31H43N7O7 — CID 158005359
acetic acid;2-[6-(3-amino-5-butoxyphenyl)-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]-N-[(4-carbamimidoylphenyl)methyl]acetamide (PubChem CID 158005359) has the molecular formula C31H43N7O7 and a molecular weight of 625.73 g/mol. Its IUPAC name is acetic acid;2-[6-(3-amino-5-butoxyphenyl)-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]-N-[(4-carbamimidoylphenyl)methyl]acetamide.
| Compound Name | acetic acid;2-[6-(3-amino-5-butoxyphenyl)-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]-N-[(4-carbamimidoylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 158005359 |
| Molecular Formula | C31H43N7O7 |
| Molecular Weight | 625.73 g/mol |
| Exact Mass | 625.32 |
| IUPAC Name | acetic acid;2-[6-(3-amino-5-butoxyphenyl)-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]-N-[(4-carbamimidoylphenyl)methyl]acetamide |
| SMILES | CC(=O)O.CC(=O)O.[H]/N=C(\N)c1ccc(CNC(=O)Cn2c(-c3cc(N)cc(OCCCC)c3)cnc(NC(C)C)c2=O)cc1 |
| InChI | InChI=1S/C27H35N7O3.2C2H4O2/c1-4-5-10-37-22-12-20(11-21(28)13-22)23-15-32-26(33-17(2)3)27(36)34(23)16-24(35)31-14-18-6-8-19(9-7-18)25(29)30;2*1-2(3)4/h6-9,11-13,15,17H,4-5,10,14,16,28H2,1-3H3,(H3,29,30)(H,31,35)(H,32,33);2*1H3,(H,3,4) |
| InChIKey | VENWCKZTJHVNPM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 235.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.73 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|