C28H38Cl2N8O5 — CID 159990700
3-amino-N-[(2S)-butan-2-yl]-5-[1-[2-[(4-carbamimidoyl-2,6-dihydroxyphenyl)methylamino]-2-oxoethyl]-6-oxo-5-(propan-2-ylamino)pyrazin-2-yl]benzamide;dihydrochloride (PubChem CID 159990700) has the molecular formula C28H38Cl2N8O5 and a molecular weight of 637.57 g/mol. Its IUPAC name is 3-amino-N-[(2S)-butan-2-yl]-5-[1-[2-[(4-carbamimidoyl-2,6-dihydroxyphenyl)methylamino]-2-oxoethyl]-6-oxo-5-(propan-2-ylamino)pyrazin-2-yl]benzamide;dihydrochloride.
| Compound Name | 3-amino-N-[(2S)-butan-2-yl]-5-[1-[2-[(4-carbamimidoyl-2,6-dihydroxyphenyl)methylamino]-2-oxoethyl]-6-oxo-5-(propan-2-ylamino)pyrazin-2-yl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 159990700 |
| Molecular Formula | C28H38Cl2N8O5 |
| Molecular Weight | 637.57 g/mol |
| Exact Mass | 636.23 |
| IUPAC Name | 3-amino-N-[(2S)-butan-2-yl]-5-[1-[2-[(4-carbamimidoyl-2,6-dihydroxyphenyl)methylamino]-2-oxoethyl]-6-oxo-5-(propan-2-ylamino)pyrazin-2-yl]benzamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1cc(O)c(CNC(=O)Cn2c(-c3cc(N)cc(C(=O)N[C@@H](C)CC)c3)cnc(NC(C)C)c2=O)c(O)c1 |
| InChI | InChI=1S/C28H36N8O5.2ClH/c1-5-15(4)35-27(40)18-6-16(7-19(29)8-18)21-12-33-26(34-14(2)3)28(41)36(21)13-24(39)32-11-20-22(37)9-17(25(30)31)10-23(20)38;;/h6-10,12,14-15,37-38H,5,11,13,29H2,1-4H3,(H3,30,31)(H,32,39)(H,33,34)(H,35,40);2*1H/t15-;;/m0../s1 |
| InChIKey | FTOWEVOKASDOTH-CKUXDGONSA-N |
| XLogP | 2.70 |
| TPSA | 221.47 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.57 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|