C24H27ClN8O4 — CID 10230056
3-amino-5-[1-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-3-chloro-5-(2-ethyl-2-methylhydrazinyl)-6-oxopyrazin-2-yl]benzoic acid (PubChem CID 10230056) has the molecular formula C24H27ClN8O4 and a molecular weight of 526.99 g/mol. Its IUPAC name is 3-amino-5-[1-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-3-chloro-5-(2-ethyl-2-methylhydrazinyl)-6-oxopyrazin-2-yl]benzoic acid.
| Compound Name | 3-amino-5-[1-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-3-chloro-5-(2-ethyl-2-methylhydrazinyl)-6-oxopyrazin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 10230056 |
| Molecular Formula | C24H27ClN8O4 |
| Molecular Weight | 526.99 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | 3-amino-5-[1-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-3-chloro-5-(2-ethyl-2-methylhydrazinyl)-6-oxopyrazin-2-yl]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)Cn2c(-c3cc(N)cc(C(=O)O)c3)c(Cl)nc(NN(C)CC)c2=O)cc1 |
| InChI | InChI=1S/C24H27ClN8O4/c1-3-32(2)31-22-23(35)33(12-18(34)29-11-13-4-6-14(7-5-13)21(27)28)19(20(25)30-22)15-8-16(24(36)37)10-17(26)9-15/h4-10H,3,11-12,26H2,1-2H3,(H3,27,28)(H,29,34)(H,30,31)(H,36,37) |
| InChIKey | KLKQVQRGEIWMCS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 192.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.99 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|