C24H28ClN7O2 — CID 10885334
N-[(4-carbamimidoylphenyl)methyl]-2-[5-chloro-3-[2-(dimethylamino)ethylamino]-2-oxo-6-phenylpyrazin-1-yl]acetamide (PubChem CID 10885334) has the molecular formula C24H28ClN7O2 and a molecular weight of 481.99 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-2-[5-chloro-3-[2-(dimethylamino)ethylamino]-2-oxo-6-phenylpyrazin-1-yl]acetamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-2-[5-chloro-3-[2-(dimethylamino)ethylamino]-2-oxo-6-phenylpyrazin-1-yl]acetamide |
|---|---|
| PubChem CID | 10885334 |
| Molecular Formula | C24H28ClN7O2 |
| Molecular Weight | 481.99 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-2-[5-chloro-3-[2-(dimethylamino)ethylamino]-2-oxo-6-phenylpyrazin-1-yl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)Cn2c(-c3ccccc3)c(Cl)nc(NCCN(C)C)c2=O)cc1 |
| InChI | InChI=1S/C24H28ClN7O2/c1-31(2)13-12-28-23-24(34)32(20(21(25)30-23)17-6-4-3-5-7-17)15-19(33)29-14-16-8-10-18(11-9-16)22(26)27/h3-11H,12-15H2,1-2H3,(H3,26,27)(H,28,30)(H,29,33) |
| InChIKey | WQIHEHKDRLQNNL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.99 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|