C27H22ClF6N7O4 — CID 159627631
N-[(4-carbamimidoylphenyl)methyl]-2-[5-chloro-3-(2-isocyanoethylamino)-2-oxo-6-phenylpyrazin-1-yl]acetamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 159627631) has the molecular formula C27H22ClF6N7O4 and a molecular weight of 657.96 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-2-[5-chloro-3-(2-isocyanoethylamino)-2-oxo-6-phenylpyrazin-1-yl]acetamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-2-[5-chloro-3-(2-isocyanoethylamino)-2-oxo-6-phenylpyrazin-1-yl]acetamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 159627631 |
| Molecular Formula | C27H22ClF6N7O4 |
| Molecular Weight | 657.96 g/mol |
| Exact Mass | 657.13 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-2-[5-chloro-3-(2-isocyanoethylamino)-2-oxo-6-phenylpyrazin-1-yl]acetamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | O=C(C(=O)C(F)(F)F)C(F)(F)F.[H]/N=C(\N)c1ccc(CNC(=O)Cn2c(-c3ccccc3)c(Cl)nc(NCC[N+]#[C-])c2=O)cc1 |
| InChI | InChI=1S/C23H22ClN7O2.C4F6O2/c1-27-11-12-28-22-23(33)31(19(20(24)30-22)16-5-3-2-4-6-16)14-18(32)29-13-15-7-9-17(10-8-15)21(25)26;5-3(6,7)1(11)2(12)4(8,9)10/h2-10H,11-14H2,(H3,25,26)(H,28,30)(H,29,32); |
| InChIKey | MORZGFUVUZTWBZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 164.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.96 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|