C23H22ClN7O2 — CID 20608772
N-[(4-carbamimidoylphenyl)methyl]-2-[5-chloro-3-(2-isocyanoethylamino)-2-oxo-6-phenylpyrazin-1-yl]acetamide (PubChem CID 20608772) has the molecular formula C23H22ClN7O2 and a molecular weight of 463.93 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-2-[5-chloro-3-(2-isocyanoethylamino)-2-oxo-6-phenylpyrazin-1-yl]acetamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-2-[5-chloro-3-(2-isocyanoethylamino)-2-oxo-6-phenylpyrazin-1-yl]acetamide |
|---|---|
| PubChem CID | 20608772 |
| Molecular Formula | C23H22ClN7O2 |
| Molecular Weight | 463.93 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-2-[5-chloro-3-(2-isocyanoethylamino)-2-oxo-6-phenylpyrazin-1-yl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)Cn2c(-c3ccccc3)c(Cl)nc(NCC[N+]#[C-])c2=O)cc1 |
| InChI | InChI=1S/C23H22ClN7O2/c1-27-11-12-28-22-23(33)31(19(20(24)30-22)16-5-3-2-4-6-16)14-18(32)29-13-15-7-9-17(10-8-15)21(25)26/h2-10H,11-14H2,(H3,25,26)(H,28,30)(H,29,32) |
| InChIKey | DJSWOVDKEAXVMN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.93 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|