C30H33ClN6O2 — CID 11734268
2-[3-(1-adamantylamino)-5-chloro-2-oxo-6-phenylpyrazin-1-yl]-N-[(4-carbamimidoylphenyl)methyl]acetamide (PubChem CID 11734268) has the molecular formula C30H33ClN6O2 and a molecular weight of 545.09 g/mol. Its IUPAC name is 2-[3-(1-adamantylamino)-5-chloro-2-oxo-6-phenylpyrazin-1-yl]-N-[(4-carbamimidoylphenyl)methyl]acetamide.
| Compound Name | 2-[3-(1-adamantylamino)-5-chloro-2-oxo-6-phenylpyrazin-1-yl]-N-[(4-carbamimidoylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 11734268 |
| Molecular Formula | C30H33ClN6O2 |
| Molecular Weight | 545.09 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | 2-[3-(1-adamantylamino)-5-chloro-2-oxo-6-phenylpyrazin-1-yl]-N-[(4-carbamimidoylphenyl)methyl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)Cn2c(-c3ccccc3)c(Cl)nc(NC34CC5CC(CC(C5)C3)C4)c2=O)cc1 |
| InChI | InChI=1S/C30H33ClN6O2/c31-26-25(22-4-2-1-3-5-22)37(17-24(38)34-16-18-6-8-23(9-7-18)27(32)33)29(39)28(35-26)36-30-13-19-10-20(14-30)12-21(11-19)15-30/h1-9,19-21H,10-17H2,(H3,32,33)(H,34,38)(H,35,36) |
| InChIKey | XLIQCRQADHGIPI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.09 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|